CAS 491581-72-7

6-(2-aminophenyl)-3-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one

Description:

6-(2-Aminophenyl)-3-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one is a heterocyclic compound characterized by its complex structure, which includes a thiazole ring fused with a triazine moiety. This compound features an amino group attached to a phenyl ring, contributing to its potential biological activity. The presence of both thiazole and triazine rings suggests that it may exhibit interesting electronic properties and reactivity, making it a candidate for various applications in medicinal chemistry. The methyl group at the 3-position of the thiazole ring can influence its solubility and stability. Additionally, the compound's unique structure may allow for interactions with biological targets, potentially leading to pharmacological effects. Its CAS number, 491581-72-7, facilitates its identification in chemical databases, aiding researchers in accessing relevant literature and data regarding its synthesis, properties, and potential applications. Overall, this compound represents a class of molecules that may hold promise in drug discovery and development.

Formula: C₁₂H₁₀N₄OS

InChI: InChI=1/C12H10N4OS/c1-7-6-18-12-14-11(17)10(15-16(7)12)8-4-2-3-5-9(8)13/h2-6H,13H2,1H3

SMILES: Cc1csc2nc(=O)c(c3ccccc3N)nn12

Synonyms:

• 6-(2-Amino-phenyl)-3-methyl-thiazolo[3,2-b][1,2,4]triazin-7-one

6-(2-aminophenyl)-3-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one

CAS: 491581-72-7

Purity: 95.0%

Molecular weight: 258.29998779296875

Ref: 10-F315298