CAS 4916-57-8
:1,2-Bis(4-pyridyl)ethane
Description:
1,2-Bis(4-pyridyl)ethane, with the CAS number 4916-57-8, is an organic compound characterized by its structure, which features two 4-pyridyl groups attached to a central ethane backbone. This compound is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. It exhibits notable coordination chemistry, often forming complexes with transition metals, which makes it of interest in various fields such as materials science and catalysis. The presence of pyridine rings contributes to its basicity and potential as a ligand in coordination complexes. Additionally, 1,2-Bis(4-pyridyl)ethane can participate in hydrogen bonding and π-π stacking interactions, influencing its physical properties and reactivity. Its applications extend to areas like organic synthesis, where it may serve as a building block for more complex molecules, and in the development of molecular sensors or as a component in supramolecular chemistry. Overall, its unique structural features and reactivity profile make it a valuable compound in both academic and industrial research.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H,1-2H2
InChI key:InChIKey=DQRKTVIJNCVZAX-UHFFFAOYSA-N
SMILES:C(CC=1C=CN=CC1)C=2C=CN=CC2
Synonyms:- 1,2-Di-4-pyridylethane
- 1,2-Bis(4-pyridyl)ethane
- Pyridine, 4,4′-ethylenedi-
- 4,4′-(1,2-Ethanediyl)bis[pyridine]
- Pyridine, 4,4′-(1,2-ethanediyl)bis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2-Di(pyridin-4-yl)ethane
CAS:Formula:C12H12N2Purity:95%Color and Shape:SolidMolecular weight:184.23711,2-Bis(4-pyridyl)ethane
CAS:1,2-Bis(4-pyridyl)ethanePurity:98%Color and Shape:SolidMolecular weight:184.24g/molTirofiban Impurity 89
CAS:Formula:C12H12N2Color and Shape:White To Off-White SolidMolecular weight:184.241,2-Di(4-pyridyl)ethane
CAS:Formula:C12H12N2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:184.241,2-Bis-(4-pyridyl)ethane
CAS:1,2-Bis-(4-pyridyl)ethane is a fine chemical that is a versatile building block in the synthesis of complex compounds. It has been used as a research chemical and reagent for the study of DNA and RNA synthesis. 1,2-Bis-(4-pyridyl)ethane is also an important intermediate for the synthesis of drugs such as cephalosporins, which are antibiotics used to treat bacterial infections. The compound has been shown to be effective in treating MRSA infections. 1,2-Bis-(4-pyridyl)ethane can also be used as a scaffold for the synthesis of other compounds.Formula:C12H12N2Purity:Min. 97 Area-%Molecular weight:184.24 g/mol1,2-Di(pyridin-4-yl)ethane
CAS:Formula:C12H12N2Purity:98%Color and Shape:Solid, White to very pale yellow powderMolecular weight:184.242





