CAS 4916-59-0
:3-hydroxy-2,2,4,4-tetramethylcyclobutanone
Description:
3-Hydroxy-2,2,4,4-tetramethylcyclobutanone, with the CAS number 4916-59-0, is an organic compound characterized by its unique cyclobutanone structure, which features a four-membered carbon ring. This compound contains a hydroxyl group (-OH) and multiple methyl groups, contributing to its distinctive chemical properties. It is typically a colorless to pale yellow liquid with a pleasant odor, indicative of its ketone functionality. The presence of the hydroxyl group suggests that it can engage in hydrogen bonding, potentially influencing its solubility in various solvents. The bulky tetramethyl substituents can impart steric hindrance, affecting its reactivity and interactions with other molecules. This compound may be of interest in organic synthesis and could serve as a precursor or intermediate in the production of more complex chemical entities. Additionally, its unique structure may confer specific biological activities, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling it, given potential toxicity or reactivity.
Formula:C8H14O2
InChI:InChI=1/C8H14O2/c1-7(2)5(9)8(3,4)6(7)10/h5,9H,1-4H3
SMILES:CC1(C)C(C(C)(C)C1=O)O
Synonyms:- Cyclobutanone, 3-Hydroxy-2,2,4,4-Tetramethyl-
- 3-Hydroxy-2,2,4,4-tetramethylcyclobutanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Hydroxy-2,2,4,4-tetramethylcyclobutan-1-one
CAS:<p>3-Hydroxy-2,2,4,4-tetramethylcyclobutan-1-one is a monomer that is soluble in organic solvents. It can be isolated by centrifugation of the reaction mixture and purified by filtration or recrystallization. 3-Hydroxy-2,2,4,4-tetramethylcyclobutan-1-one has been used as a catalyst for the polymerization of ethylene oxide to polyethers. 3-Hydroxy-2,2,4,4-tetramethylcyclobutan-1-one is also an excellent solvent for ruthenium metal and can be used as a reaction solvent for reactions involving this metal.</p>Formula:C8H14O2Purity:Min. 95%Molecular weight:142.2 g/mol
