CAS 4918-96-1
:Pyrocatechol sulfate
Description:
Pyrocatechol sulfate, also known as 3,4-dihydroxyphenyl sulfate, is an organic compound characterized by the presence of a sulfate group attached to a pyrocatechol structure, which consists of a benzene ring with two hydroxyl groups in the ortho position. This compound is typically a white to off-white solid and is soluble in water due to the polar nature of the sulfate group. Pyrocatechol sulfate is known for its role in various biochemical processes, particularly in the metabolism of catecholamines and as a potential biomarker in certain physiological conditions. It exhibits antioxidant properties, which can contribute to its biological activity. The compound is also of interest in research related to its potential therapeutic applications and its behavior in environmental contexts. As with many sulfate esters, it may undergo hydrolysis under certain conditions, releasing pyrocatechol and sulfate ions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C6H6O5S
InChI:InChI=1S/C6H6O5S/c7-5-3-1-2-4-6(5)11-12(8,9)10/h1-4,7H,(H,8,9,10)
InChI key:InChIKey=MZPWKJZDOCIALD-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)O)C1=C(O)C=CC=C1
Synonyms:- 1,2-Benzenediol, mono(hydrogen sulfate)
- Pyrocatechol sulfate
- Pyrocatechol, hydrogen sulfate
- 1,2-Benzenediol, 1-(hydrogen sulfate)
- Pyrocatechol, mono(hydrogen sulfate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Catechol-d4 Sulfate Sodium Salt
CAS:Formula:C6HD4O5S·NaColor and Shape:White To Off-White SolidMolecular weight:193.19 22.99Pyrocatechol sulfate
CAS:Pyrocatechol sulfate, a phenolic metabolite found in human plasma, is associated with the intake of specific foods such as berries and the state of the gut microbiome. It serves as a potential urinary biomarker for kidney function, dialysis clearance rates, whole grain consumption, and regular coffee intake. Additionally, in conjunction with other phenolic sulfates, pyrocatechol sulfate plays a role in regulating various biological functions, including those related to brain health and the rhythmic beating of cardiac cells.Formula:C6H6O5SColor and Shape:SolidMolecular weight:190.17

