CAS 491833-29-5: N-[(1R,2R)-2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]octanamide
Description:N-[(1R,2R)-2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]octanamide, with CAS number 491833-29-5, is a synthetic organic compound characterized by its complex structure, which includes a benzodioxin moiety and a pyrrolidine group. This compound is typically classified as an amide due to the presence of the octanamide functional group. Its stereochemistry is defined by the (1R,2R) configuration, indicating specific spatial arrangements of its atoms, which can influence its biological activity and interactions. The presence of hydroxyl and amine functional groups suggests potential for hydrogen bonding, which may enhance solubility in polar solvents. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structural features could contribute to specific biological activities, although detailed studies would be necessary to elucidate its mechanisms of action and potential applications. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C23H36N2O4
InChI:InChI=1S/C23H36N2O4/c1-2-3-4-5-6-9-22(26)24-19(17-25-12-7-8-13-25)23(27)18-10-11-20-21(16-18)29-15-14-28-20/h10-11,16,19,23,27H,2-9,12-15,17H2,1H3,(H,24,26)/t19-,23-/m1/s1
InChI key:InChIKey=FJZZPCZKBUKGGU-AUSIDOKSSA-N
SMILES:O=C(NC(CN1CCCC1)C(O)C2=CC=C3OCCOC3=C2)CCCCCCC
- Synonyms:
- Cerdelga
- Octanamide, N-[(1R,2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]-
- Genz 99067
- N-[(1R,2R)-2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]-octanamide
- N-[(1R,2R)-2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]octanamide
- Eliglustat
![N-[(1R,2R)-2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]octanamide](https://static.cymitquimica.com/cas-image/327497-n-1r-2r-2-23-dihydro-14-benzodioxin-6-yl-2-hydroxy-1-1-pyrrolidinylmethyl-ethyl-octanamide.png)
