CymitQuimica logo

CAS 491833-36-4

:

(5S)-5-Phenyl-2-morpholinone hydrochloride

Description:
(5S)-5-Phenyl-2-morpholinone hydrochloride is a chemical compound characterized by its morpholinone structure, which includes a morpholine ring and a phenyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the hydrochloride salt form enhances its stability and solubility. The specific stereochemistry indicated by the (5S) designation suggests that it has a defined three-dimensional arrangement, which can significantly influence its biological activity and interactions. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its properties, such as melting point, boiling point, and spectral data (NMR, IR, etc.), would be essential for characterizing its purity and confirming its identity in research and industrial applications. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H12ClNO2
InChI:InChI=1S/C10H11NO2.ClH/c12-10-6-11-9(7-13-10)8-4-2-1-3-5-8;/h1-5,9,11H,6-7H2;1H/t9-;/m1./s1
InChI key:QAUUHFOYPUBYQU-SBSPUUFOSA-N
SMILES:C1[C@@H](NCC(=O)O1)C2=CC=CC=C2.Cl
Found 4 products.