CAS 491879-29-9

B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid

Description:

B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a propenyl substituent. This compound features a boron atom bonded to a hydroxyl group and an alkene, specifically a chlorinated propenyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom enhances its electrophilic character, making it useful in cross-coupling reactions, particularly in the formation of carbon-carbon bonds. Boronic acids are known for their ability to form stable complexes with diols, which can be exploited in various chemical processes, including the development of sensors and drug delivery systems. Additionally, this compound may exhibit unique properties such as solubility in polar solvents and the ability to participate in various chemical transformations, including Suzuki-Miyaura coupling reactions. Overall, B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid is a versatile building block in synthetic organic chemistry.

Formula: C₃H₆BClO₂

InChI: InChI=1S/C3H6BClO2/c5-3-1-2-4(6)7/h1-2,6-7H,3H2/b2-1+

InChI key: InChIKey=JMTGSXGIIONQHI-OWOJBTEDSA-N

SMILES: C(\B(O)O)=C/CCl

Synonyms:

• (trans-2-Chloromethylethenyl)boronic acid
• (E)-3-Chloro-1-propenylboronic acid
• Boronic acid, [(1E)-3-chloro-1-propenyl]-
• B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid
• Boronic acid, B-[(1E)-3-chloro-1-propen-1-yl]-

B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid

CAS: 491879-29-9

Formula: C₃H₆BClO₂

Molecular weight: 120.3425

Ref: IN-DA01GCUX

(E)-(3-Chloroprop-1-en-1-yl)boronic acid

CAS: 491879-29-9

(E)-(3-Chloroprop-1-en-1-yl)boronic acid

Formula: C₃H₆BClO₂

Purity: 98%

Molecular weight: 120.34

Ref: IN-DG01207895

B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid

CAS: 491879-29-9

B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid is a biologically active molecule that inhibits the synthesis of dopamine by competing with L-DOPA. It is used as a fluorescent probe for dopamine. B-[(1E)-3-Chloro-1-propen-1-yl]boronic acid has been shown to inhibit the activity of various enzymes, including human serum albumin and human alpha amylase. It can be used in polymerase chain reaction (PCR) and electrochemical impedance spectroscopy (EIS) to detect dopamine in biological samples.

Formula: C₃H₆BClO₂

Purity: Min. 95%

Molecular weight: 120.34 g/mol

Ref: 3D-RUA87929