CAS 4919-04-4
:5-Amino-1H-imidazole-4-carboxylic acid
Description:
5-Amino-1H-imidazole-4-carboxylic acid, also known as AICA or AICAR, is a heterocyclic organic compound characterized by its imidazole ring structure, which contains both amino and carboxylic acid functional groups. This compound is a derivative of imidazole and is notable for its role as a precursor in the biosynthesis of purines. It is soluble in water, which facilitates its biological activity, and it exhibits properties that make it of interest in various biochemical and pharmacological studies. AICA has been investigated for its potential effects on metabolism, particularly in relation to exercise performance and muscle growth, as it may activate AMP-activated protein kinase (AMPK). Additionally, it has been studied for its potential therapeutic applications in conditions such as diabetes and cardiovascular diseases. The compound's molecular structure contributes to its reactivity and interactions with other biological molecules, making it a significant subject of research in medicinal chemistry and biochemistry.
Formula:C4H5N3O2
InChI:InChI=1S/C4H5N3O2/c5-3-2(4(8)9)6-1-7-3/h1H,5H2,(H,6,7)(H,8,9)
InChI key:InChIKey=PWCLNQLPYQVWAB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)N=CN1
Synonyms:- Imidazole-4(or 5)-carboxylic acid, 5(or 4)-amino-
- 1H-Imidazole-4-carboxylic acid, 5-amino-
- 4-Amino-5-imidazolecarboxylic acid
- 5-Amino-1H-imidazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
