CAS 4919-37-3: 4-Hydroxy-3,5-dimethylbenzoic acid
Description:4-Hydroxy-3,5-dimethylbenzoic acid, also known as 4-hydroxy-3,5-xylidic acid, is an aromatic carboxylic acid characterized by the presence of a hydroxyl group and a carboxylic acid functional group attached to a benzene ring that also features two methyl substituents. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, with limited solubility in water. It exhibits properties typical of phenolic compounds, including potential antioxidant activity due to the hydroxyl group. The presence of the methyl groups contributes to its hydrophobic character, influencing its reactivity and interactions in various chemical environments. 4-Hydroxy-3,5-dimethylbenzoic acid can be synthesized through various organic reactions, including the methylation of benzoic acid derivatives. It is used in research and industrial applications, particularly in the synthesis of pharmaceuticals and agrochemicals, owing to its functional groups that can participate in further chemical transformations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3,(H,11,12)
InChI key:InChIKey=OMNHTTWQSSUZHO-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C(O)=C(C1)C)C
- Synonyms:
- 2,6-Dimethyl-4-carboxyphenol
- 3,5-Dimethyl-4-hydroxybenzoic acid
- 4-Hydroxy-3,5-Dimethylbenzoate
- Benzoic acid, 4-hydroxy-3,5-dimethyl-
- NSC 68319
- 4-Hydroxy-3,5-dimethylbenzoic acid
