CAS 4919-40-8

4-Amino-3,5-dimethylbenzoic acid

Description:

4-Amino-3,5-dimethylbenzoic acid, also known as 4-amino-2,6-dimethylbenzoic acid, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring that also features two methyl groups at the 3 and 5 positions. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, depending on the pH. It exhibits properties typical of amino acids, including the ability to form salts and participate in various chemical reactions, such as acylation and amidation. The presence of the amino group allows it to act as a weak base, while the carboxylic acid group contributes to its acidic nature. 4-Amino-3,5-dimethylbenzoic acid is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Its biological activity and potential applications in medicinal chemistry are subjects of ongoing research.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4H,10H2,1-2H3,(H,11,12)

InChI key: InChIKey=NZEOOPXCKUWJDQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(C)=C(N)C(C)=C1

Synonyms:

• 3,5-Dimethyl-4-aminobenzoic acid
• Benzoic Acid, 4-Amino-3,5-Dimethyl-
• NSC 38033
• 4-Amino-3,5-dimethylbenzoic acid

4-Amino-3,5-dimethylbenzoic acid

CAS: 4919-40-8

Formula: C₉H₁₁NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA00712Z

4-Amino-3,5-dimethylbenzoic acid

CAS: 4919-40-8

4-Amino-3,5-dimethylbenzoic acid

Purity: 98%

Molecular weight: 165.19g/mol

Ref: 54-OR93917

4-Amino-3,5-dimethylbenzoic acid

CAS: 4919-40-8

Formula: C₉H₁₁NO₂

Purity: 98%

Color and Shape: Solid, Yellow powder

Molecular weight: 165.192

Ref: 10-F075176