CAS 492-08-0
:(+)-Sparteine
Description:
(+)-Sparteine is a naturally occurring alkaloid primarily derived from the plant species *Lupinus* (lupins). It is characterized by its chiral structure, exhibiting optical activity due to the presence of a stereocenter, which contributes to its enantiomeric form. The compound has a molecular formula of C11H14N2 and features a bicyclic structure that includes a piperidine ring. (+)-Sparteine is known for its role as a ligand in coordination chemistry and has applications in asymmetric synthesis, particularly in the formation of chiral compounds. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. Additionally, (+)-Sparteine has been studied for its pharmacological properties, including potential effects on the central nervous system and its use in various chemical reactions as a chiral auxiliary. Its unique properties make it a valuable compound in both synthetic organic chemistry and medicinal research.
Formula:C15H26N2
InChI:InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m1/s1
InChI key:InChIKey=SLRCCWJSBJZJBV-TUVASFSCSA-N
SMILES:[C@]12([C@@]3(N(C[C@@](C1)([C@]4(N(C2)CCCC4)[H])[H])CCCC3)[H])[H]
Synonyms:- (7R,7aR,14R,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine
- 6α,7β,9β,11β-Sparteine
- 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine, dodecahydro-, (7R,7aR,14R,14aS)-
- 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine, dodecahydro-, [7R-(7α,7aα,14α,14aβ)]-
- <span class="text-smallcaps">D</span>-(+)-Sparteine
- Pachycarpine
- d-Sparteine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
(+)-Sparteine
CAS:Formula:C15H26N2Purity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:234.39(+)-Sparteine
CAS:Formula:C15H26N2Purity:≥ 98.0%Color and Shape:Yellow to dark yellow or dark green liquidMolecular weight:234.39(+)-Spartein
CAS:(+)-SparteinFormula:C15H26N2Purity:97%Color and Shape: yellow liquidMolecular weight:234.38g/mol(+)-Sparteine
CAS:(+)-Sparteine is a quinoline alkaloid extracted from Scotch broom, a sodium channel blocker and a class 1a antiarrhythmic agent.Cost-effective and quality-assured.Formula:C15H26N2Purity:99.9% - 99.98%Color and Shape:SolidMolecular weight:234.38(+)-Sparteine
CAS:<p>Applications (+)-Sparteine (cas# 492-08-0) is a useful research chemical.<br></p>Formula:C15H26N2Color and Shape:NeatMolecular weight:234.38(+)-Sparteine
CAS:<p>Sparteines are alkaloids extracted from Legumes of the gender Lupinus acting as sodium channel blockers and antiarrhythmic agents. Interestingly, different Lupinus species can produce opposite enantiomers of Sparteine; for instance the (-) enantiomer is found in Lupinus luteus and the (+) enantiomer is found in Lupinus pusillus, respectively. Sparteine alkaloids find numerous applications in synthetic chemistry, especially in asymmetric lithiation reactions.</p>Formula:C15H26N2Molecular weight:234.38 g/mol(+)-Sparteine
CAS:<p>Sparteine acts as an inhibitor of voltage-gated sodium channels. In organic chemisty, it is used for chiral synthesis.</p>Formula:C15H26N2Purity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:234.38 g/mol(+)-Sparteine
CAS:Formula:C15H26N2Purity:98.0%Color and Shape:Liquid or Viscous LiquidMolecular weight:234.387








