CAS 492-62-6
:α-D-Glucose
Description:
α-D-Glucose, also known as alpha-D-glucopyranose, is a monosaccharide and an essential carbohydrate in biology. It is a six-carbon sugar (hexose) with the molecular formula C6H12O6. In its α-anomeric form, the hydroxyl group on the first carbon atom is oriented downward in the cyclic structure, which is a pyranose form. This configuration plays a crucial role in its reactivity and interactions with other biomolecules. α-D-Glucose is highly soluble in water due to its multiple hydroxyl groups, which can form hydrogen bonds with water molecules. It serves as a primary energy source for cells and is involved in various metabolic pathways, including glycolysis and the citric acid cycle. Additionally, α-D-Glucose can polymerize to form polysaccharides like starch and glycogen, which are vital for energy storage in plants and animals, respectively. Its sweetness and fermentability make it significant in food chemistry and the production of alcoholic beverages. Overall, α-D-Glucose is a fundamental building block in biochemistry and plays a critical role in energy metabolism.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1
InChI key:InChIKey=WQZGKKKJIJFFOK-DVKNGEFBSA-N
SMILES:C(O)[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)O1
Synonyms:- D-Glucose
- Glucopyranose, α-<span class="text-smallcaps">D</span>-
- Glucopyranose, α-D-
- α-<span class="text-smallcaps">D</span>-Glucopyranose
- α-<span class="text-smallcaps">D</span>-Glucose
- α-D-GLUCOPYRANOSIDE
- α-D-Glucose
- α-D-glucosa
- α-Dextrose
- α-Glucose
- α-D-Glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(2S,3R,4S,5S,6R)-6-(Hydroxymethyl)Tetrahydro-2H-Pyran-2,3,4,5-Tetraol
CAS:(2S,3R,4S,5S,6R)-6-(Hydroxymethyl)Tetrahydro-2H-Pyran-2,3,4,5-TetraolPurity:96%Molecular weight:180.16g/molα-D-glucose
CAS:α-D-glucose, naturally in fruits/plants, is an energy source used in fluid/nutrient therapy.Formula:C6H12O6Purity:99.87%Color and Shape:White Crystalline Powder OdurlessMolecular weight:180.16a-D-Glucose
CAS:Glucose is a monosaccharide that is an important source of energy for the human body. It is a simple sugar found in many carbohydrates and is the main form of fuel used by the brain. Glucose is also used as a chemical building block for polysaccharides such as glycogen, cellulose, and chitin. The hypoglycemic effect of glucose can be observed when blood glucose levels are below 70 mg/dL. This effect can be due to its ability to increase the production of insulin or decrease the rate of gluconeogenesis in liver cells. It also has been shown to have an inhibitory effect on some viruses and bacteria, which may be due to its ability to inhibit transcription activators or polymerase chain reactions.
Formula:C6H12O6Purity:Min. 96 Area-%Color and Shape:White PowderMolecular weight:180.16 g/mol






