CAS 492-91-1
:3-(8,11-Pentadecadien-1-yl)-1,2-benzenediol
Description:
3-(8,11-Pentadecadien-1-yl)-1,2-benzenediol, also known by its CAS number 492-91-1, is an organic compound characterized by its unique structure, which features a long hydrocarbon chain and a diol functional group. This compound consists of a benzene ring substituted with two hydroxyl (-OH) groups at the 1 and 2 positions, and a pentadecadienyl side chain at the 3 position. The presence of the long unsaturated hydrocarbon chain contributes to its hydrophobic characteristics, while the hydroxyl groups enhance its solubility in polar solvents. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of various natural products or pharmaceuticals. Its structural features suggest potential applications in fields such as biochemistry and materials science. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C21H32O2
InChI:InChI=1S/C21H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h4-5,7-8,15,17-18,22-23H,2-3,6,9-14,16H2,1H3
InChI key:InChIKey=RMTXUPIIESNLPW-UHFFFAOYSA-N
SMILES:C(CCCCCCC=CCC=CCCC)C1=C(O)C(O)=CC=C1
Synonyms:- 1,2-benzenediol, 3-(8,11-pentadecadien-1-yl)-
- 1,2-Dihydroxy-3-(pentadeca-8,11-dienyl)benzene
- 3-(8,11-Pentadecadien-1-yl)-1,2-benzenediol
- 1,2-Benzenediol, 3-(8,11-pentadecadienyl)-
- Pyrocatechol, 3-(8,11-pentadecadienyl)-
- 1,2-Benzenediol, 3-(8,11-pentadecadien-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(8,11-Pentadecadienyl)-1,2-benzenediol
CAS:3-(8,11-Pentadecadienyl)-1,2-benzenediol is a useful organic compound for research related to life sciences.Formula:C21H32O2Color and Shape:SolidMolecular weight:316.485
