CAS 4920-80-3
:3-Methoxy-2-nitrobenzoic acid
Description:
3-Methoxy-2-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH₃) and a nitro group (-NO₂) attached to a benzoic acid framework. The presence of these functional groups imparts unique chemical properties, such as increased acidity due to the carboxylic acid group and potential for electrophilic substitution reactions. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The nitro group is a strong electron-withdrawing group, which can influence the reactivity of the compound in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, 3-Methoxy-2-nitrobenzoic acid may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling, as nitro compounds can be hazardous. Overall, this compound serves as a valuable intermediate in organic synthesis and research applications.
Formula:C8H7NO5
InChI:InChI=1S/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=YMOMYSDAOXOCID-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(O)=O)C=CC=C1OC
Synonyms:- 2-Nitro-3-Methoxybenzoic Acid
- 2-Nitro-m-anisic acid
- 3-Methoxy-2-Nitrobenzoate
- Benzoic acid, 3-methoxy-2-nitro-
- NSC 609
- m-Anisic acid, 2-nitro-
- 3-Methoxy-2-nitrobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Methoxy-2-nitrobenzoic Acid
CAS:Formula:C8H7NO5Purity:>99.0%(T)Color and Shape:White to Almost white powder to crystalineMolecular weight:197.153-METHOXY-2-NITROBENZOIC ACID
CAS:Formula:C8H7NO5Purity:98%Color and Shape:SolidMolecular weight:197.14493-Methoxy-2-nitrobenzoic acid
CAS:3-Methoxy-2-nitrobenzoic acidPurity:98%Molecular weight:197.14g/mol3-Methoxy-2-nitrobenzoic acid
CAS:Formula:C8H7NO5Purity:98%Color and Shape:Solid, CrystallineMolecular weight:197.1463-Methoxy-2-nitrobenzoic acid
CAS:Controlled Product<p>Applications 3-Methoxy-2-nitrobenzoic acid<br></p>Formula:C8H7NO5Color and Shape:NeatMolecular weight:197.153-Methoxy-2-nitrobenzoic acid
CAS:<p>3-Methoxy-2-nitrobenzoic acid is a cytotoxic agent that has low activity against sarcoma cells. This drug blocks topoisomerase, preventing the separation of DNA strands and causing death to the sarcoma cells. 3-Methoxy-2-nitrobenzoic acid also has nonhematologic toxicities, such as tissue damage and high levels of methemoglobin in the blood. It is operable for children and adults, but not for pregnant women. The drug is administered in combination with dacarbazine or as a single agent in pediatric populations at doses lower than those used in adults. 3-Methoxy-2-nitrobenzoic acid may be used to treat cancers such as leukemia, lymphoma, Hodgkin's disease, Wilms' tumor, neuroblastoma, rhabdomyosarcoma, or retinoblastoma.</p>Formula:C8H7NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:197.14 g/mol






