CAS 4923-06-2: 3,5-di(pyridin-4-yl)-1H-1,2,4-triazol-1-amine

Description:3,5-Di(pyridin-4-yl)-1H-1,2,4-triazol-1-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features two pyridine groups attached to the triazole, enhancing its potential for coordination with metal ions and increasing its biological activity. The presence of the amino group (-NH2) contributes to its reactivity and solubility in polar solvents. It is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in drug discovery. Additionally, its structural features allow for potential modifications to optimize its efficacy and selectivity. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coordination chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula:C₁₂H₁₀N₆

InChI:InChI=1/C12H10N6/c13-18-12(10-3-7-15-8-4-10)16-11(17-18)9-1-5-14-6-2-9/h1-8H,13H2