CymitQuimica logo

CAS 492445-92-8

:

[4-(2-Oxoimidazolidin-1-yl)phenyl]acetic acid

Description:
[4-(2-Oxoimidazolidin-1-yl)phenyl]acetic acid, with the CAS number 492445-92-8, is a chemical compound characterized by its unique structure that includes an imidazolidine ring and a phenyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the imidazolidine moiety. It may demonstrate moderate solubility in polar solvents, influenced by the presence of the carboxylic acid, while its aromatic character can contribute to hydrophobic interactions. The compound may also exhibit biological activity, potentially acting as a ligand or a precursor in pharmaceutical applications. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, [4-(2-Oxoimidazolidin-1-yl)phenyl]acetic acid represents a versatile structure with potential applications in medicinal chemistry and related fields.
Formula:C11H12N2O3
InChI:InChI=1/C11H12N2O3/c14-10(15)7-8-1-3-9(4-2-8)13-6-5-12-11(13)16/h1-4H,5-7H2,(H,12,16)(H,14,15)
InChI key:SAUIBPUGJQBOSH-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=O)O)N1CCN=C1O
Synonyms:
  • Benzeneacetic Acid, 4-(2-Oxo-1-Imidazolidinyl)-
  • [4-(2-Oxo-Imidazolidin-1-Yl)-Phenyl]-Acetic Acid
Found 4 products.