
CAS 492446-45-4
:1-(2-fluoroethyl)piperidin-4-ol
Description:
1-(2-Fluoroethyl)piperidin-4-ol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a hydroxyl group (-OH) at the 4-position of the piperidine ring contributes to its potential as a secondary amine, influencing its reactivity and solubility in polar solvents. The 2-fluoroethyl substituent introduces a fluorine atom, which can enhance the compound's lipophilicity and may affect its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as the fluorine atom can modulate pharmacokinetic properties. Additionally, the presence of both the hydroxyl and fluorinated groups may impart unique interactions with biological targets, making it a candidate for further research in therapeutic contexts. Its molecular structure and functional groups suggest that it may participate in hydrogen bonding and other intermolecular interactions, which are critical for its behavior in biological systems.
Formula:C7H14FNO
InChI:InChI=1/C7H14FNO/c8-3-6-9-4-1-7(10)2-5-9/h7,10H,1-6H2
SMILES:C1CN(CCC1O)CCF
Synonyms:- 1-(2-Fluoroethyl)-4-hydroxypiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(2-Fluoroethyl)-4-hydroxypiperidine
CAS:<p>1-(2-Fluoroethyl)-4-hydroxypiperidine</p>Color and Shape:LiquidMolecular weight:147.19g/mol

