CymitQuimica logo

CAS 4925-61-5

:

6-Chloropyrazin-2-ol

Description:
6-Chloropyrazin-2-ol is a heterocyclic organic compound characterized by the presence of a pyrazine ring substituted with a chlorine atom and a hydroxyl group. Its molecular structure consists of a six-membered aromatic ring containing two nitrogen atoms, which contributes to its basicity and potential reactivity. The chlorine substituent at the 6-position enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The hydroxyl group at the 2-position provides the compound with polar characteristics, increasing its solubility in polar solvents and influencing its interaction with biological systems. 6-Chloropyrazin-2-ol may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anti-inflammatory agents. Additionally, its unique structural features allow for potential applications in agrochemicals and materials science. As with many chlorinated compounds, safety and environmental considerations are important, necessitating careful handling and disposal in laboratory settings.
Formula:C4H3ClN2O
InChI:InChI=1/C4H3ClN2O/c5-3-1-6-2-4(8)7-3/h1-2H,(H,7,8)
InChI key:SKZXVUPFUHQWKS-UHFFFAOYSA-N
SMILES:c1c(Cl)[nH]c(=O)cn1
Synonyms:
  • 2-Pyrazinol, 6-chloro-
  • 6-Chloro-2-Hydroxypyrazine
Found 5 products.