CAS 4926-52-7

2-chloro-3-nitroimidazo[1,2-a]pyridine

Description:

2-Chloro-3-nitroimidazo[1,2-a]pyridine is a heterocyclic compound characterized by its imidazo-pyridine structure, which incorporates both chlorine and nitro functional groups. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. The presence of the chlorine atom and the nitro group contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry and pharmacology. The imidazo[1,2-a]pyridine framework is known for its role in various biological applications, including antimicrobial and antitumor activities. The compound's molecular structure allows for interactions with biological targets, which can lead to significant pharmacological effects. Additionally, its stability under standard conditions and the ability to undergo various chemical reactions, such as nucleophilic substitutions, further enhance its utility in synthetic organic chemistry. Safety data should be consulted for handling, as compounds with halogen and nitro groups can pose health risks.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1/C7H4ClN3O2/c8-6-7(11(12)13)10-4-2-1-3-5(10)9-6/h1-4H

SMILES: c1ccn2c(c1)nc(c2N(=O)=O)Cl

Synonyms:

• Imidazo[1,2-a]pyridine, 2-chloro-3-nitro-
• MPYABESQQVTTRX-UHFFFAOYSA-N

Imidazo[1,2-a]pyridine, 2-chloro-3-nitro-

CAS: 4926-52-7

Formula: C₇H₄ClN₃O₂

Purity: 98%

Molecular weight: 197.5786

Ref: IN-DA00I8UC

2-Chloro-3-nitroimidazo[1,2-a]pyridine

CAS: 4926-52-7

2-Chloro-3-nitroimidazo[1,2-a]pyridine

Purity: ≥95%

Molecular weight: 197.58g/mol

Ref: 54-OR450073

2-Chloro-3-nitroimidazo[1,2-a]pyridine

CAS: 4926-52-7

Purity: 98%

Molecular weight: 197.5800018

Ref: 10-F639114

2-Chloro-3-nitroimidazo[1,2-a]pyridine

CAS: 4926-52-7

2-Chloro-3-nitroimidazo[1,2-a]pyridine is a chlorinated derivative of imidazo[1,2-a]pyridine. The nitro group gives the molecule two sites for functionalization and enables it to undergo Suzuki coupling reactions with anilines. The chloro substituent provides the molecule with a high degree of chemical diversity. This compound can be used in cross-coupling reactions with anilines and other heterocycles, such as thiophenes and furans. In addition, this compound has been shown to react with nucleophiles in a nucleophilic substitution reaction to form 2-chloro-5-(substituted)imidazo[1,2-a]pyridinium ions.

Formula: C₇H₄ClN₃O₂

Purity: Min. 95%

Molecular weight: 197.58 g/mol

Ref: 3D-EAA92652