CAS 493038-57-6

5-Tricyclo[3.3.1.13,7]dec-1-yl-1H-pyrazole-3-methanol

Description:

5-Tricyclo[3.3.1.1^3,7]dec-1-yl-1H-pyrazole-3-methanol, identified by its CAS number 493038-57-6, is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring and a tricyclic decane framework. This compound features a hydroxymethyl group (-CH2OH) attached to the pyrazole, which can influence its reactivity and solubility. The presence of the tricyclic system contributes to its rigidity and potential for specific interactions in biological systems. Such structural characteristics may impart interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's synthesis typically involves multi-step organic reactions, and its stability can be influenced by environmental factors such as temperature and pH. Additionally, the compound's potential applications may include roles in drug development or as a research tool in various biochemical assays. Understanding its properties, including solubility, melting point, and reactivity, is essential for further exploration in both academic and industrial settings.

Formula: C₁₄H₂₀N₂O

InChI: InChI=1S/C14H20N2O/c17-8-12-4-13(16-15-12)14-5-9-1-10(6-14)3-11(2-9)7-14/h4,9-11,17H,1-3,5-8H2,(H,15,16)

InChI key: InChIKey=PSBSTRRGNORRCZ-UHFFFAOYSA-N

SMILES: C(O)C=1C=C(C23CC4CC(C2)CC(C3)C4)NN1

Synonyms:

• [3-(Adamantan-1-yl)-1H-pyrazol-5-yl]methanol
• 5-Tricyclo[3.3.1.13,7]dec-1-yl-1H-pyrazole-3-methanol
• 1H-Pyrazole-3-methanol, 5-tricyclo[3.3.1.13,7]dec-1-yl-

[3-(Adamantan-1-yl)-1H-pyrazol-5-yl]methanol

CAS: 493038-57-6

Versatile small molecule scaffold

Formula: C₁₄H₂₀N₂O

Purity: Min. 95%

Molecular weight: 232.32 g/mol

Ref: 3D-TUA03857