CAS 4933-84-0
:6-aminocyclohexane-1,2,3,4,5-pentol
Description:
6-Aminocyclohexane-1,2,3,4,5-pentol, also known by its CAS number 4933-84-0, is an organic compound characterized by a cyclohexane ring with five hydroxyl (-OH) groups and one amino (-NH2) group. This structure makes it a polyol and an amine, contributing to its potential as a versatile building block in organic synthesis and pharmaceuticals. The presence of multiple hydroxyl groups imparts significant hydrophilicity, enhancing its solubility in water and making it useful in various applications, including as a potential chiral auxiliary in asymmetric synthesis. The amino group can participate in further chemical reactions, such as forming amides or undergoing alkylation. Additionally, the compound's stereochemistry can lead to different isomeric forms, which may exhibit distinct physical and chemical properties. Overall, 6-aminocyclohexane-1,2,3,4,5-pentol is notable for its multifunctionality and potential utility in chemical research and industrial applications.
Formula:C6H14ClNO5
InChI:InChI=1/C6H13NO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6,8-12H,7H2
SMILES:C1(C(C(C(C(C1O)O)O)O)O)N
Synonyms:- scyllo-Inosamine hydrochloride
- NSC 275619
- Bluensamine hydrochloride
- 1-Amino-1-deoxy-scyllo-inositol hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Amino-1-deoxy-scyllo-inositol hydrochloride
CAS:1-Amino-1-deoxy-scyllo-inositol hydrochlorideColor and Shape:SolidMolecular weight:215.63g/molscyllo-Inosamine hydrochloride
CAS:Scyllo-inosamine is a synthetic compound that is used as an oxime for the treatment of ascites tumors. It is synthesized from benzyl cyanide and cyclohexane. The benzyl groups are removed by catalytic hydrogenation, and the resulting product is hydrolyzed to scyllo-inosamine. Scyllo-inosamine has been shown to have a stereogenic center at C3, which allows it to act as an aminocyclitol, with the nitrogen atom acting as a nucleophile in the ring opening reaction. Scyllo-inosamine has been shown to be active against a number of tumor cells in culture and has been investigated as chemotherapeutic agent for cancer treatment.Formula:C6H13NO4·HClPurity:Min. 95%Molecular weight:199.63 g/mol


