CAS 4939-91-7
:octahydronaphthalene-1,4-dione
Description:
Octahydronaphthalene-1,4-dione, also known as 1,4-dihydroxy-1,4-dihydronaphthalene, is a bicyclic organic compound characterized by its structure, which features a naphthalene core with two carbonyl (ketone) groups at the 1 and 4 positions. This compound is a colorless to pale yellow solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. Its molecular formula reflects a saturated hydrocarbon framework, contributing to its relatively stable nature. Octahydronaphthalene-1,4-dione is of interest in various chemical applications, including organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of the carbonyl groups imparts reactivity, allowing for further chemical modifications. Additionally, it may exhibit interesting properties such as fluorescence or photochemical behavior, making it a subject of study in materials science and organic chemistry. Safety data should be consulted for handling, as with any chemical substance.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h7-8H,1-6H2
Synonyms:- 1,4-Naphthalenedione, octahydro-
- Octahydro-1,4-naphthalenedione
- cis-Decalin-1,4-dione
- Decalin-1,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decalin-1,4-dione
CAS:<p>Decalin-1,4-dione is a biochemical.</p>Formula:C10H14O2Color and Shape:SolidMolecular weight:166.22
