
CAS 494-40-6
:1,2,4-Trimethoxy-5-(1-propenyl)benzene
Description:
1,2,4-Trimethoxy-5-(1-propenyl)benzene, with the CAS number 494-40-6, is an organic compound belonging to the class of methoxy-substituted phenolic compounds. It features a benzene ring substituted with three methoxy groups and a propenyl group, which contributes to its unique chemical properties. This compound is characterized by its aromatic structure, which imparts stability and influences its reactivity. The presence of methoxy groups enhances its solubility in organic solvents and can affect its biological activity, making it of interest in various fields, including medicinal chemistry and natural product synthesis. Additionally, the propenyl substituent can participate in further chemical reactions, such as polymerization or electrophilic substitution. 1,2,4-Trimethoxy-5-(1-propenyl)benzene may exhibit antioxidant properties and has been studied for potential applications in pharmaceuticals and agrochemicals. Its synthesis typically involves the functionalization of a suitable precursor compound, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity.
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3
InChI key:InChIKey=RKFAZBXYICVSKP-UHFFFAOYSA-N
SMILES:C(=CC)C1=C(OC)C=C(OC)C(OC)=C1
Synonyms:- Benzene, 1,2,4-trimethoxy-5-(1-propenyl)-
- Benzene, 1,2,4-trimethoxy-5-(1-propen-1-yl)-
- Benzene, 1,2,4-trimethoxy-5-propenyl-
- 1,2,4-Trimethoxy-5-(1-propen-1-yl)benzene
- 2,4,5-Trimethoxy-1-propenylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
