CAS 4943-67-3
:5-methyl-1H-pyrrolo[3,2-b]pyridine
Description:
5-Methyl-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a methyl group at the 5-position of the pyrrole ring, which influences its chemical reactivity and properties. It is typically a solid at room temperature and exhibits a range of polar and non-polar characteristics due to the presence of nitrogen atoms in its structure. The compound is of interest in medicinal chemistry and may exhibit biological activity, making it a subject of research for potential pharmaceutical applications. Its molecular structure contributes to its ability to participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Additionally, 5-methyl-1H-pyrrolo[3,2-b]pyridine can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to determine its purity and structural integrity. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C8H8N2
InChI:InChI=1/C8H8N2/c1-6-2-3-7-8(10-6)4-5-9-7/h2-5,9H,1H3
SMILES:Cc1ccc2c(cc[nH]2)n1
Synonyms:- 1H-pyrrolo[3,2-b]pyridine, 5-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:Formula:C8H8N2Purity:97%Color and Shape:SolidMolecular weight:132.16255-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:5-Methyl-1H-pyrrolo[3,2-b]pyridinePurity:97%Molecular weight:132.16g/mol5-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:Formula:C8H8N2Purity:97%Color and Shape:SolidMolecular weight:132.1665-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:<p>5-Methyl-1H-pyrrolo[3,2-b]pyridine is a versatile compound that has various applications in different industries. It is commonly used in the production of polyvinyl and interferon, as well as in the synthesis of glycine and glutamate. This compound also finds its use in biomass production, where it acts as a catalyst for the growth of nanofibers. Additionally, 5-Methyl-1H-pyrrolo[3,2-b]pyridine has been studied for its potential therapeutic properties, including its ability to inhibit cytochalasin activity and the synthesis of oligosaccharides. Its unique chemical structure also makes it suitable for the development of copolymers and styrenic electrode materials.</p>Formula:C8H8N2Purity:Min. 95%Molecular weight:132.16 g/mol



