CAS 4943-82-2

2-amino-N-(prop-2-en-1-yl)benzamide

Description:

2-amino-N-(prop-2-en-1-yl)benzamide, with the CAS number 4943-82-2, is an organic compound characterized by its amine and amide functional groups. It features a benzene ring substituted with an amino group and an allyl group (prop-2-en-1-yl) attached to the nitrogen of the amide. This structure imparts both polar and non-polar characteristics, making it soluble in various organic solvents while exhibiting some degree of solubility in water due to the presence of the amino and amide functionalities. The compound may participate in hydrogen bonding due to the amine and amide groups, influencing its reactivity and interaction with other molecules. It can be used in organic synthesis and may serve as a precursor for various chemical reactions, including those involving nucleophilic substitutions or polymerizations. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, where modifications to the benzamide structure can lead to compounds with specific biological activities.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c1-2-7-12-10(13)8-5-3-4-6-9(8)11/h2-6H,1,7,11H2,(H,12,13)

SMILES: C=CCN=C(c1ccccc1N)O

Synonyms:

• benzamide, 2-amino-N-2-propen-1-yl-
• N-allyl-2-aminobenzamide

N-Allyl-2-aminobenzamide

CAS: 4943-82-2

Formula: C₁₀H₁₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.2151

Ref: IN-DA00DIGA

N-Allyl-2-aminobenzamide

CAS: 4943-82-2

N-Allyl-2-aminobenzamide

Purity: 97%

Molecular weight: 176.22g/mol

Ref: 54-OR1056527

N-Allyl-2-aminobenzamide

CAS: 4943-82-2

Purity: 97%

Molecular weight: 176.2189941

Ref: 10-F692896

N-Allyl-2-aminobenzamide

CAS: 4943-82-2

2-Bromobenzaldehyde (2BA) is a reactive chemical that can be used as a building block for the synthesis of many other chemicals. It is also an efficient catalyst for reactions such as the reduction of amines to amides, and the conversion of nitroarenes to amines. 2BA has been shown to be cytotoxic in vitro and in vivo against human cancer cell lines when attached to magnetic nanoparticles and immobilized on different surfaces. The cytotoxic activity of 2BA was analyzed by using intramolecular cycloaddition reactions with electron-deficient olefins, which led to valuable insights into the mechanism of this reaction.

Formula: C₁₀H₁₂N₂O

Purity: Min. 95%

Molecular weight: 176.22 g/mol

Ref: 3D-EAA94382