CAS 4946-36-5

9-azabicyclo[6.2.0]decan-10-one

Description:

9-Azabicyclo[6.2.0]decan-10-one, with the CAS number 4946-36-5, is a bicyclic compound characterized by a nitrogen atom incorporated into a bicyclic structure. This compound features a unique arrangement of carbon atoms forming a bicyclic framework, which includes a ketone functional group at the 10-position. The presence of the nitrogen atom contributes to its basicity and potential for forming hydrogen bonds, influencing its reactivity and interaction with other chemical species. Typically, compounds of this type exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The bicyclic structure can also impart rigidity, affecting the compound's conformation and, consequently, its biological activity. Additionally, 9-azabicyclo[6.2.0]decan-10-one may participate in various chemical reactions, including nucleophilic substitutions and cyclizations, due to the presence of the ketone group. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in organic synthesis and drug development.

Formula: C₉H₁₅NO

InChI: InChI=1/C9H15NO/c11-9-7-5-3-1-2-4-6-8(7)10-9/h7-8H,1-6H2,(H,10,11)

SMILES: C1CCCC2C(CC1)C(=N2)O

9-Azabicyclo[6.2.0]decan-10-one

CAS: 4946-36-5

9-Azabicyclo[6.2.0]decan-10-one is a lactam that can be synthesized by reacting diisopropyl with β-amino acid. 9-Azabicyclo[6.2.0]decan-10-one has been shown to have high enantioselectivity and enantiopurity, which is due to the use of a chiral catalyst in the synthesis process. This compound is also an intermediate for the synthesis of β-lactams such as penicillin, cephalosporin, and carbapenem antibiotics, which are used to treat bacterial infections. The enzymes in these β-lactams are inhibited by binding to their active site, preventing them from breaking down peptidoglycan during cell wall synthesis.

Formula: C₉H₁₅NO

Purity: Min. 95%

Molecular weight: 153.22 g/mol

Ref: 3D-EAA94636