CAS 494763-25-6

3-bromo-5-[(4-methylbenzyl)sulfonyl]-1,2,4-thiadiazole

Description:

3-bromo-5-[(4-methylbenzyl)sulfonyl]-1,2,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring substituted with a bromine atom and a sulfonyl group attached to a 4-methylbenzyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom and sulfonyl group. The thiadiazole ring contributes to its biological activity, making it of interest in pharmaceutical research. The sulfonyl group enhances the compound's ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the methyl group on the benzyl ring may influence its lipophilicity and overall biological interactions. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₀H₉BrN₂O₂S₂

InChI: InChI=1/C10H9BrN2O2S2/c1-7-2-4-8(5-3-7)6-17(14,15)10-12-9(11)13-16-10/h2-5H,6H2,1H3

SMILES: Cc1ccc(cc1)CS(=O)(=O)c1nc(Br)ns1

Synonyms:

• 1,2,4-Thiadiazole, 3-bromo-5-[[(4-methylphenyl)methyl]sulfonyl]-
• 3-Bromo-5-[(4-methylbenzyl)sulfonyl]-1,2,4-thiadiazole

3-Bromo-5-(4-methylbenzylsulfonyl)-1,2,4-thiadiazole

CAS: 494763-25-6

Formula: C₁₀H₉BrN₂O₂S₂

Color and Shape: Solid

Molecular weight: 333.22

Ref: 10-F024098