CymitQuimica logo

CAS 494763-25-6

:

3-bromo-5-[(4-methylbenzyl)sulfonyl]-1,2,4-thiadiazole

Description:
3-bromo-5-[(4-methylbenzyl)sulfonyl]-1,2,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring substituted with a bromine atom and a sulfonyl group attached to a 4-methylbenzyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom and sulfonyl group. The thiadiazole ring contributes to its biological activity, making it of interest in pharmaceutical research. The sulfonyl group enhances the compound's ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the methyl group on the benzyl ring may influence its lipophilicity and overall biological interactions. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C10H9BrN2O2S2
InChI:InChI=1/C10H9BrN2O2S2/c1-7-2-4-8(5-3-7)6-17(14,15)10-12-9(11)13-16-10/h2-5H,6H2,1H3
SMILES:Cc1ccc(cc1)CS(=O)(=O)c1nc(Br)ns1
Synonyms:
  • 1,2,4-Thiadiazole, 3-bromo-5-[[(4-methylphenyl)methyl]sulfonyl]-
  • 3-Bromo-5-[(4-methylbenzyl)sulfonyl]-1,2,4-thiadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.