CAS 494763-26-7

3-Chloro-5-[[(4-methylphenyl)methyl]sulfonyl]-1,2,4-thiadiazole

Description:

3-Chloro-5-[[(4-methylphenyl)methyl]sulfonyl]-1,2,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a chlorine atom, and a sulfonyl group attached to a methyl-substituted phenyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the sulfonyl group often enhances the compound's reactivity and may contribute to its pharmacological properties. Additionally, the chlorine atom can influence the compound's lipophilicity and overall stability. Due to its specific functional groups, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to regulatory scrutiny depending on its intended use. Overall, 3-Chloro-5-[[(4-methylphenyl)methyl]sulfonyl]-1,2,4-thiadiazole represents a class of compounds that could have significant applications in various fields of chemistry and biology.

Formula: C₁₀H₉ClN₂O₂S₂

InChI: InChI=1S/C10H9ClN2O2S2/c1-7-2-4-8(5-3-7)6-17(14,15)10-12-9(11)13-16-10/h2-5H,6H2,1H3

InChI key: InChIKey=MTLNWFGSCTWRRF-UHFFFAOYSA-N

SMILES: S(CC1=CC=C(C)C=C1)(=O)(=O)C2=NC(Cl)=NS2

Synonyms:

• 1,2,4-Thiadiazole, 3-chloro-5-[[(4-methylphenyl)methyl]sulfonyl]-
• 3-Chloro-5-[[(4-methylphenyl)methyl]sulfonyl]-1,2,4-thiadiazole

3-Chloro-5-(4-methylbenzylsulfonyl)-1,2,4-thiadiazole

CAS: 494763-26-7

Formula: C₁₀H₉ClN₂O₂S₂

Molecular weight: 288.76

Ref: 10-F024099