CymitQuimica logo

CAS 494767-42-9

:

4-Chloro-N,N-dimethyl-1H-pyrrolo[3,2-c]pyridine-1-acetamide

Description:
4-Chloro-N,N-dimethyl-1H-pyrrolo[3,2-c]pyridine-1-acetamide is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a chloro substituent and dimethyl groups. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring system. The presence of the chloro group may influence its reactivity and solubility, while the dimethyl groups can affect its steric properties and overall molecular stability. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures have been linked to various biological activities. The compound's molecular weight, melting point, and solubility characteristics would be relevant for practical applications and synthesis. Additionally, safety data and handling precautions are essential when working with this substance, as with any chemical compound, to ensure safe laboratory practices.
Formula:C11H12ClN3O
InChI:InChI=1S/C11H12ClN3O/c1-14(2)10(16)7-15-6-4-8-9(15)3-5-13-11(8)12/h3-6H,7H2,1-2H3
InChI key:InChIKey=BZGYWVIBQZKCRD-UHFFFAOYSA-N
SMILES:C(C(N(C)C)=O)N1C=2C(C=C1)=C(Cl)N=CC2
Synonyms:
  • 2-(4-Chloro-1H-pyrrolo[3,2-c]pyridin-1-yl)-N,N-dimethylacetamide
  • 1H-Pyrrolo[3,2-c]pyridine-1-acetamide, 4-chloro-N,N-dimethyl-
  • 4-Chloro-N,N-dimethyl-1H-pyrrolo[3,2-c]pyridine-1-acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.