CAS 494769-34-5

(4-Formylthiazol-2-yl)carbamic acid tert-butyl ester

Description:

(4-Formylthiazol-2-yl)carbamic acid tert-butyl ester is a chemical compound characterized by its unique structural features, which include a thiazole ring and a carbamic acid moiety. The thiazole ring contributes to its heterocyclic nature, while the formyl group introduces reactivity, making it a potential candidate for various chemical transformations. The tert-butyl ester group enhances its lipophilicity, which can influence its solubility and bioavailability in biological systems. This compound may exhibit interesting biological activities due to the presence of the thiazole and carbamic acid functionalities, which are often associated with pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Its synthesis typically involves the reaction of appropriate thiazole derivatives with carbamic acid derivatives, followed by esterification. Overall, (4-Formylthiazol-2-yl)carbamic acid tert-butyl ester represents a versatile structure in organic chemistry, with potential applications in medicinal chemistry and material science.

Formula: C₉H₁₂N₂O₃S

InChI: InChI=1/C9H12N2O3S/c1-9(2,3)14-8(13)11-7-10-6(4-12)5-15-7/h4-5H,1-3H3,(H,10,11,13)

SMILES: CC(C)(C)OC(=Nc1nc(C=O)cs1)O

Synonyms:

• carbamic acid, N-(4-formyl-2-thiazolyl)-, 1,1-dimethylethyl ester
• tert-Butyl (4-formyl-1,3-thiazol-2-yl)carbamate

N-Boc-2-Amino-4-formylthiazole

CAS: 494769-34-5

Formula: C₉H₁₂N₂O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 228.2682

Ref: IN-DA006ZVP

N-Boc-2-Amino-4-formylthiazole

CAS: 494769-34-5

N-Boc-2-Amino-4-formylthiazole

Purity: 95%

Molecular weight: 228.27g/mol

Ref: 54-OR1005605

N-Boc-2-Amino-4-formylthiazole

CAS: 494769-34-5

Formula: C₉H₁₂N₂O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 228.27

Ref: 10-F078781