CAS 494776-07-7

2-amino-6,6-dimethyl-5,8-dihydro-6H-pyrano[3,4-b]pyridine-3-carboxylic acid

Description:

2-amino-6,6-dimethyl-5,8-dihydro-6H-pyrano[3,4-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyridine and pyran rings. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a biologically active molecule. The presence of two methyl groups at the 6-position of the pyridine ring enhances its steric properties and may influence its reactivity and solubility. The dihydropyrano structure suggests that it may participate in various chemical reactions, including those typical of pyridine derivatives, such as nucleophilic substitutions or electrophilic additions. Its unique structure may also confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 494776-07-7, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, this compound exemplifies the diversity and complexity of organic molecules with potential applications in science and industry.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1/C11H14N2O3/c1-11(2)4-6-3-7(10(14)15)9(12)13-8(6)5-16-11/h3H,4-5H2,1-2H3,(H2,12,13)(H,14,15)

SMILES: CC1(C)Cc2cc(c(N)nc2CO1)C(=O)O

Synonyms:

• 2-Amino-6,6-dimethyl-5,8-dihydro-6H-pyrano[3,4-b]pyridine-3-carboxylic acid

2-amino-6,6-dimethyl-5,8-dihydro-6H-pyrano[3,4-b]pyridine-3-carboxylic acid

CAS: 494776-07-7

Formula: C₁₁H₁₄N₂O₃

Purity: 95.0%

Molecular weight: 222.244

Ref: 10-F311716