CAS 495-30-7
:Marmesinin
Description:
Marmesinin, with the CAS number 495-30-7, is a naturally occurring alkaloid primarily derived from the plant species of the genus Marmesin. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Marmesinin exhibits a range of pharmacological properties, including potential anti-inflammatory and antioxidant effects, making it of interest in medicinal chemistry and pharmacology. Its solubility characteristics can vary, often being more soluble in organic solvents than in water, which influences its extraction and application in various formulations. Additionally, marmesinin's stability and reactivity can be affected by environmental conditions such as pH and temperature. Research into marmesinin continues to explore its potential therapeutic applications, as well as its mechanisms of action at the molecular level. Overall, marmesinin represents a significant compound within the realm of natural products, with ongoing studies aimed at elucidating its full range of biological effects and potential uses in health and medicine.
Formula:C20H24O9
InChI:InChI=1S/C20H24O9/c1-20(2,29-19-18(25)17(24)16(23)13(8-21)28-19)14-6-10-5-9-3-4-15(22)27-11(9)7-12(10)26-14/h3-5,7,13-14,16-19,21,23-25H,6,8H2,1-2H3/t13-,14+,16-,17+,18-,19+/m1/s1
InChI key:InChIKey=HXCGUCZXPFBNRD-NEDVQNLSSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(C)(C)[C@@H]2CC=3C(=CC4=C(C3)C=CC(=O)O4)O2
Synonyms:- Ammajin
- Marmesinin
- (2S)-2-[1-(β-D-Glucopyranosyloxy)-1-methylethyl]-2,3-dihydro-7H-furo[3,2-g][1]benzopyran-7-one
- 7H-Furo[3,2-g][1]benzopyran-7-one, 2-[1-(β-D-glucopyranosyloxy)-1-methylethyl]-2,3-dihydro-, (S)-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 2-[1-(β-D-glucopyranosyloxy)-1-methylethyl]-2,3-dihydro-, (2S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7H-Furo(3,2-g)(1)benzopyran-7-one, 2-(1-(β-D-glucopyranosyloxy)-1-m ethylethyl)-2,3-dihydro-, (S)-
CAS:Formula:C20H24O9Purity:96.0%Color and Shape:SolidMolecular weight:408.3992(-)-Marmesinin
CAS:(-)-Marmesinin (Ammijin) is a linear furanocoumarin isolated from Aegle marmelose, with antioxidant and neuroprotective activities.Formula:C20H24O9Purity:98%Color and Shape:SolidMolecular weight:408.4Marmesinin
CAS:Marmesinin is a furanocoumarin compound, which is a type of phytochemical derived from certain plant species. It is specifically obtained from the plant Aegle marmelos, commonly known as the bael tree. Marmesinin acts primarily through mechanisms that are characteristic of coumarins, such as influencing biochemical pathways involved in cellular growth and immune response modulation.Formula:C20H24O9Purity:Min. 95%Molecular weight:408.4 g/mol




