CAS 495-52-3

1,2,3,5,6,7-hexahydro-s-indacene

Description:

1,2,3,5,6,7-Hexahydro-s-indacene, with the CAS number 495-52-3, is a bicyclic organic compound characterized by its unique structure that includes a fused ring system. This compound is a saturated hydrocarbon, meaning it contains only single bonds between carbon atoms, which contributes to its stability. It is typically a colorless to pale yellow liquid at room temperature and has a relatively low boiling point compared to other hydrocarbons. The compound is insoluble in water but soluble in organic solvents, which is common for hydrocarbons. Its molecular structure allows for interesting chemical reactivity, particularly in cycloaddition reactions and as a potential intermediate in organic synthesis. Additionally, hexahydro-s-indacene may exhibit interesting physical properties such as a moderate density and specific refractive index, which can be relevant in applications involving optics or materials science. Overall, its unique structure and properties make it a compound of interest in various fields of chemistry, including organic synthesis and materials development.

Formula: C₁₂H₁₄

InChI: InChI=1/C12H14/c1-3-9-7-11-5-2-6-12(11)8-10(9)4-1/h7-8H,1-6H2

SMILES: C1Cc2cc3CCCc3cc2C1

Synonyms:

• s-Hydrindacene
• S-Indacene, 1,2,3,5,6,7-Hexahydro-
• 1,2,3,5,6,7-Hexahydro-s-indacene

1,2,3,5,6,7-Hexahydro-S-Indacene

CAS: 495-52-3

Formula: C₁₂H₁₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.2396

Ref: IN-DA01DHX1

1,2,3,5,6,7-Hexahydro-s-indacene

CAS: 495-52-3

1,2,3,5,6,7-Hexahydro-s-indacene

Purity: 95%

Molecular weight: 158.24g/mol

Ref: 54-OR79136

1,2,3,5,6,7-Hexahydro-s-indacene

CAS: 495-52-3

Purity: 97%

Molecular weight: 158.24400329589844

Ref: 10-F608963

s-Hydrindacene

Controlled Product

CAS: 495-52-3

Applications s-Hydrindacene is a useful building block for organic synthesis.

Formula: C₁₂H₁₄

Color and Shape: Neat

Molecular weight: 158.24

Ref: TR-H294520