CAS 495-78-3
:Melilotic acid
Description:
Melilotic acid, with the CAS number 495-78-3, is a naturally occurring organic compound classified as a phenolic acid. It is primarily derived from the plant species Melilotus, commonly known as sweet clover. This compound is characterized by its aromatic structure, which includes a hydroxyl group (-OH) attached to a benzene ring, contributing to its phenolic properties. Melilotic acid exhibits various biological activities, including potential anti-inflammatory and antioxidant effects, making it of interest in pharmacological research. It is soluble in polar solvents, which enhances its bioavailability in biological systems. Additionally, melilotic acid may play a role in plant defense mechanisms and has been studied for its potential applications in food preservation and natural product synthesis. Its chemical behavior is influenced by the presence of functional groups, allowing for various reactions typical of phenolic compounds, such as esterification and oxidation. Overall, melilotic acid represents a significant compound in both natural product chemistry and potential therapeutic applications.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4,10H,5-6H2,(H,11,12)
InChI key:InChIKey=CJBDUOMQLFKVQC-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=C(O)C=CC=C1
Synonyms:- 2-Hydroxybenzenepropanoic acid
- 2-Hydroxyhydrocinnamic acid
- 3-(2-Hydroxyphenyl)Propanoate
- 3-(2-Hydroxyphenyl)propanoic acid
- Benzenepropanoic acid, 2-hydroxy-
- Hydro-o-coumaric acid
- Hydrocinnamic acid, o-hydroxy-
- Hydrocoumaric acid
- Melilotic acid
- Salicylacetic acid
- o-Hydroxyhydrocinnamic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-(2-hydroxyphenyl)propanoic acid
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.1739Melilotic acid, 10mM (in DMSO)
CAS:Melilotic acid, 10mM (in DMSO)Purity:≥98%Molecular weight:166.17g/mol3-(2-hydroxyphenyl)propanoic acid
CAS:3-(2-hydroxyphenyl)propanoic acidPurity:98%Molecular weight:166.17389g/molMelilotic acid
CAS:3-(2-Hydroxyphenyl)propanoic acid, aka melilotic acid, found in cytoplasm, in foods like herbs, beetroot, cinnamon.Formula:C9H10O3Purity:99.65% - 99.83%Color and Shape:SolidMolecular weight:166.173-(2-Hydroxyphenyl)propionic Acid
CAS:Controlled ProductApplications 3-(2-Hydroxyphenyl)Propionic Acid (cas# 495-78-3) is a useful research chemical.
Formula:C9H10O3Color and Shape:NeatMolecular weight:166.173-(2-Hydroxyphenyl)propionic acid
CAS:3-(2-Hydroxyphenyl)propionic acid (HPPA) is an inorganic acid that is found in microbial metabolism. HPPA has been shown to inhibit the growth of bacteria by reacting with the hydroxyl group on the enzyme's active site, thus irreversibly inhibiting enzymatic activity. HPPA can be used as an alternative to other inorganic acids such as p-hydroxybenzoic acid and malonic acid due to its ability to scavenge anion radicals. This inhibition of enzyme activity can be used in wastewater treatment to remove organic compounds from industrial waste streams. It also has been shown to have anti-cancer properties against human breast cancer cells, which may be due to its ability to induce cell death through apoptosis and/or necrosis.Formula:C9H10O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:166.17 g/mol3-(2-Hydroxyphenyl)propionic acid
CAS:Formula:C9H10O3Purity:95%Color and Shape:SolidMolecular weight:166.176






