CAS 495382-05-3

5-bromo-N-cyclopropylthiophene-2-carboxamide

Description:

5-bromo-N-cyclopropylthiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiophene ring, a bromine substituent, and a cyclopropyl group attached to an amide functional group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The thiophene ring contributes to the compound's aromatic properties, potentially affecting its electronic characteristics and interactions with other molecules. The cyclopropyl group is known for its strain and can impart unique steric effects, influencing the compound's overall stability and reactivity. As an amide, it exhibits typical amide characteristics, such as hydrogen bonding capabilities, which can affect its solubility in polar solvents. This compound may have applications in medicinal chemistry or materials science, given its structural features that could interact with biological targets or contribute to specific material properties. However, detailed studies would be necessary to fully understand its behavior and potential applications.

Formula: C₈H₈BrNOS

InChI: InChI=1/C8H8BrNOS/c9-7-4-3-6(12-7)8(11)10-5-1-2-5/h3-5H,1-2H2,(H,10,11)

SMILES: C1CC1NC(=O)c1ccc(Br)s1

Synonyms:

• 2-thiophenecarboxamide, 5-bromo-N-cyclopropyl-
• 5-bromo-N-cyclopropyl-2-thiophenecarboxamide(SALTDATA: FREE)
• 2-Thiophenecarboxamide,5-bromo-N-cyclopropyl-(9CI)
• 5-bromo-N-cyclopropyl-2-thiophenecarboxamide

5-Bromo-N-cyclopropyl-2-thiophenecarboxamide

CAS: 495382-05-3

Formula: C₈H₈BrNOS

Purity: 95.0%

Molecular weight: 246.12

Ref: 10-F070314