CAS 495416-04-1
:methyl 3,6-dibromopyridine-2-carboxylate
Description:
Methyl 3,6-dibromopyridine-2-carboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted at the 3 and 6 positions with bromine atoms and at the 2 position with a carboxylate group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the presence of both bromine substituents and the carboxylate functional group, which can participate in various chemical reactions. The bromine atoms enhance the compound's reactivity, making it useful in electrophilic substitution reactions. Additionally, the methyl ester group contributes to its solubility in organic solvents, facilitating its use in various chemical processes. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, methyl 3,6-dibromopyridine-2-carboxylate is a versatile intermediate in synthetic organic chemistry.
Formula:C7H5Br2NO2
InChI:InChI=1/C7H5Br2NO2/c1-12-7(11)6-4(8)2-3-5(9)10-6/h2-3H,1H3
SMILES:COC(=O)c1c(ccc(Br)n1)Br
Synonyms:- 2-Pyridinecarboxylic Acid, 3,6-Dibromo-, Methyl Ester
- Methyl 3,6-dibromopyridine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
