CAS 49559-34-4

2-chloro-5-methoxy-1,3-benzoxazole

Description:

2-Chloro-5-methoxy-1,3-benzoxazole is an organic compound characterized by its benzoxazole core, which consists of a fused benzene and oxazole ring. The presence of a chlorine atom at the 2-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic structure. It is often used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The chlorine substituent can enhance the compound's reactivity, making it useful in electrophilic substitution reactions. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its biological activity. As with many benzoxazole derivatives, 2-chloro-5-methoxy-1,3-benzoxazole may exhibit fluorescence, making it of interest in materials science and biological imaging applications. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₆ClNO₂

InChI: InChI=1/C8H6ClNO2/c1-11-5-2-3-7-6(4-5)10-8(9)12-7/h2-4H,1H3

SMILES: COc1ccc2c(c1)nc(Cl)o2

2-Chloro-5-methoxy-1,3-benzoxazole

CAS: 49559-34-4

2-Chloro-5-methoxy-1,3-benzoxazole

Purity: ≥95%

Molecular weight: 183.59g/mol

Ref: 54-OR111200

2-Chloro-5-methoxybenzo[d]oxazole

CAS: 49559-34-4

Versatile small molecule scaffold

Formula: C₈H₆ClNO₂

Purity: Min. 95%

Molecular weight: 183.59 g/mol

Ref: 3D-ZBA55934