CAS 4956-05-2
:6-Bromo-1,2,4-triazine-3,5(2H,4H)-dione
Description:
6-Bromo-1,2,4-triazine-3,5(2H,4H)-dione, with the CAS number 4956-05-2, is a heterocyclic compound characterized by a triazine ring structure that incorporates a bromine atom and two carbonyl groups. This compound typically exhibits a pale yellow to white crystalline appearance. It is known for its potential applications in various fields, including agrochemicals and pharmaceuticals, due to its ability to act as a building block in the synthesis of more complex molecules. The presence of the bromine substituent can influence its reactivity and solubility, making it a useful intermediate in organic synthesis. Additionally, the triazine moiety contributes to its stability and can participate in various chemical reactions, such as nucleophilic substitutions. The compound's properties, including melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. Overall, 6-Bromo-1,2,4-triazine-3,5(2H,4H)-dione is a versatile compound with significant relevance in chemical research and development.
Formula:C3H2BrN3O2
InChI:InChI=1S/C3H2BrN3O2/c4-1-2(8)5-3(9)7-6-1/h(H2,5,7,8,9)
InChI key:InChIKey=VNTFEWXYAOATFA-UHFFFAOYSA-N
SMILES:O=C1C(Br)=NNC(=O)N1
Synonyms:- 1,2,4-Triazine-3,5(2H,4H)-dione, 6-bromo-
- 6-Bromo-1,2,4-triazine-3,5(2H,4H)-dione
- 6-Bromo-2,3,4,5-tetrahydro-1,2,4-triazine-3,5-dione
- 6-Bromo-3,5-dioxo-(2H,4H)-1,2,4-triazine
- as-Triazine-3,5(2H,4H)-dione, 6-bromo-
- as-Triazine-3,5-diol, 6-bromo-
- 5-Bromo-6-azauracil
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA003N3H
1g29.00€5g49.00€10g69.00€1kgTo inquire25g107.00€50g150.00€5kgTo inquire100g213.00€250g633.00€250mg25.00€6-Bromo-1,2,4-triazine-3,5(2H,4H)-dione
CAS:6-Bromo-1,2,4-triazine-3,5(2H,4H)-dioneFormula:C3H2BrN3O2Purity:96%Color and Shape: off-white powderMolecular weight:191.97g/mol6-Bromo-1,2,4-triazine-3,5(2H,4H)-dione
CAS:Formula:C3H2BrN3O2Purity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:191.9725-Bromo-6-azauracil
CAS:5-Bromo-6-azauracil is a nucleophilic compound that can be used to treat wastewater. It is also able to lyse cells and has been used as an immobilizing agent. The reactive nature of 5-Bromo-6-azauracil enables it to undergo nucleophilic substitutions with amines, which are present in the cell wall and other biomolecules. This process results in the formation of amide bonds, which leads to the inhibition of protein synthesis. 5-Bromo-6-azauracil has shown inhibitory effects on glucans, which may be due to its ability to form covalent bonds with glucose molecules.Formula:C3H2BrN3O2Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:191.97 g/mol



