CAS 4956-84-7

4-Aminocatechol diethyl ether hydrochloride

Description:

4-Aminocatechol diethyl ether hydrochloride is a chemical compound characterized by its structure, which includes an amino group and a catechol moiety, along with diethyl ether functionality. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications in organic synthesis and medicinal chemistry. The presence of the amino group suggests potential reactivity, allowing for further derivatization or participation in various chemical reactions, such as nucleophilic substitutions. The hydrochloride salt form enhances its stability and solubility in aqueous solutions, which is beneficial for biological assays or pharmaceutical formulations. Additionally, this compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.

Formula: C₁₀H₁₆ClNO₂

InChI: InChI=1/C10H15NO2.ClH/c1-3-12-9-6-5-8(11)7-10(9)13-4-2;/h5-7H,3-4,11H2,1-2H3;1H

SMILES: CCOc1ccc(cc1OCC)N.Cl

Synonyms:

• 3,4-Diethoxyaniline Hydrochloride (1:1)

3,4-Diethoxyaniline Hydrochloride

CAS: 4956-84-7

3,4-Diethoxyaniline Hydrochloride

Purity: 99%

Molecular weight: 217.69g/mol

Ref: 54-OR1027482