CymitQuimica logo

CAS 4956-86-9

:

2-[5-(4-Amino-2-propoxyphenoxy)pentyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[5-(4-Amino-2-propoxyphenoxy)pentyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 4956-86-9, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core and a side chain featuring an amino group and a propoxyphenoxy moiety. This compound is typically classified as a derivative of isoindole, which is known for its diverse biological activities. The presence of the amino group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. The propoxyphenoxy group may enhance solubility and bioavailability, contributing to its pharmacological properties. Additionally, the compound's structure indicates potential for various chemical reactions, including substitution and coupling, which can be exploited in further synthetic applications. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest in drug development and research.
Formula:C22H26N2O4
InChI:InChI=1S/C22H26N2O4/c1-2-13-27-20-15-16(23)10-11-19(20)28-14-7-3-6-12-24-21(25)17-8-4-5-9-18(17)22(24)26/h4-5,8-11,15H,2-3,6-7,12-14,23H2,1H3
InChI key:InChIKey=IIIAEJGKACTKEJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCCCCOC3=C(OCCC)C=C(N)C=C3)=CC=CC2
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-[5-(4-amino-2-propoxyphenoxy)pentyl]-
  • 2-[5-(4-Amino-2-propoxyphenoxy)pentyl]isoindole-1,3-dione
  • M and B 4023
  • Phthalimide, N-[5-(4-amino-2-propoxyphenoxy)pentyl]-
  • 2-[5-(4-Amino-2-propoxyphenoxy)pentyl]-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.