CAS 49562-76-7
:1-nitro-4-(octyloxy)benzene
Description:
1-Nitro-4-(octyloxy)benzene, with the CAS number 49562-76-7, is an organic compound characterized by the presence of a nitro group (-NO2) and an octyloxy group (-O-C8H17) attached to a benzene ring. This compound typically exhibits a yellow to brown color and is likely to be a solid at room temperature, given the presence of the long hydrophobic octyloxy chain, which can influence its solubility and melting point. The nitro group introduces polarity, which can enhance its reactivity, particularly in electrophilic substitution reactions. The octyloxy group contributes to the compound's hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound may have applications in materials science, particularly in the development of liquid crystals or as a precursor in organic synthesis. Its properties, such as thermal stability and reactivity, can be influenced by the substituents on the benzene ring, making it a subject of interest in both academic and industrial research.
Formula:C14H21NO3
InChI:InChI=1/C14H21NO3/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17/h8-11H,2-7,12H2,1H3
SMILES:CCCCCCCCOc1ccc(cc1)N(=O)=O
Synonyms:- 4-Nitrophenyl octyl ether
- Benzene, 1-nitro-4-(octyloxy)-
- p-Nitrophenyl octyl ether
- p-Octyloxynitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Nitrophenyl Octyl Ether
CAS:Controlled ProductFormula:C14H21NO3Color and Shape:NeatMolecular weight:251.321
