CymitQuimica logo

CAS 49572-64-7

:

3-iodo-2-methyl-2H-indazole

Description:
3-Iodo-2-methyl-2H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 3-position and a methyl group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry, due to its potential biological activities. The iodine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the indazole structure is known for its ability to participate in various chemical reactions, making it a valuable scaffold in drug design. Safety data should be consulted, as halogenated compounds can pose specific health and environmental risks. Overall, 3-iodo-2-methyl-2H-indazole represents a versatile compound with potential applications in research and development.
Formula:C8H7IN2
InChI:InChI=1/C8H7IN2/c1-11-8(9)6-4-2-3-5-7(6)10-11/h2-5H,1H3
InChI key:MPGNCHMFUCTNAW-UHFFFAOYSA-N
SMILES:Cn1c(c2ccccc2n1)I
Found 4 products.