CAS 4958-02-5

3-benzyloxy-cyclobutanecarboxylic acid

Description:

3-Benzyloxy-cyclobutanecarboxylic acid is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a benzyloxy group indicates that a benzyl group is attached to an oxygen atom, which is further connected to the cyclobutane framework. This compound features a carboxylic acid functional group (-COOH), contributing to its acidity and reactivity. The molecular structure allows for potential interactions such as hydrogen bonding due to the carboxylic acid, while the benzyloxy group can enhance lipophilicity and influence solubility in organic solvents. The compound may exhibit interesting chemical properties, including the ability to undergo various reactions typical of carboxylic acids, such as esterification or decarboxylation. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry and drug design. Overall, 3-benzyloxy-cyclobutanecarboxylic acid represents a versatile scaffold for further chemical modifications and applications in synthetic organic chemistry.

Formula: C₁₂H₁₄O₃

InChI: InChI=1/C12H14O3/c13-12(14)10-6-11(7-10)15-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,13,14)

SMILES: c1ccc(cc1)COC1CC(C1)C(=O)O

Synonyms:

• Acide 3-(Benzyloxy)Cyclobutanecarboxylique
• Cyclobutanecarboxylic acid, 3-(phenylmethoxy)-

3-BENZYLOXY-CYCLOBUTANECARBOXYLIC ACID

CAS: 4958-02-5

Formula: C₁₂H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.2378

Ref: IN-DA00DBCE

3-(Benzyloxy)cyclobutanecarboxylic acid

CAS: 4958-02-5

3-(Benzyloxy)cyclobutanecarboxylic acid

Purity: 97%

Molecular weight: 206.24g/mol

Ref: 54-OR308099

3-(Benzyloxy)cyclobutanecarboxylic acid

CAS: 4958-02-5

Formula: C₁₂H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.241

Ref: 10-F093560