CAS 4958-56-9

[2-(Methylamino)-5-nitrophenyl]phenylmethanone

Description:

[2-(Methylamino)-5-nitrophenyl]phenylmethanone, with the CAS number 4958-56-9, is an organic compound characterized by its complex structure, which includes a phenylmethanone moiety and a nitrophenyl group substituted with a methylamino group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the nitro group suggests that it may have electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. The methylamino group can impart basic properties, allowing for interactions with acids and other electrophiles. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic applications. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on purity and environmental conditions. Overall, [2-(Methylamino)-5-nitrophenyl]phenylmethanone represents a versatile structure with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₂N₂O₃

InChI: InChI=1S/C14H12N2O3/c1-15-13-8-7-11(16(18)19)9-12(13)14(17)10-5-3-2-4-6-10/h2-9,15H,1H3

InChI key: InChIKey=KIWZKBUUWJTGPP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(NC)C=CC(N(=O)=O)=C1)C2=CC=CC=C2

Synonyms:

• Benzophenone, 2-(methylamino)-5-nitro-
• Methanone, [2-(methylamino)-5-nitrophenyl]phenyl-
• [2-(Methylamino)-5-Nitrophenyl](Phenyl)Methanone
• [2-(Methylamino)-5-nitrophenyl]phenylmethanone
• 2-(Methylamino)-5-nitrobenzophenone

(2-Methylamino-5-nitrophenyl)phenylmethanone

Controlled Product

CAS: 4958-56-9

Applications (2-METHYLAMINO-5-NITRO-PHENYL)-PHENYL-METHANONE (cas# 4958-56-9) is a useful research chemical.

Formula: C₁₄H₁₂N₂O₃

Color and Shape: Yellow

Molecular weight: 256.25

Ref: TR-M219718