CAS 4958-56-9
:[2-(Methylamino)-5-nitrophenyl]phenylmethanone
Description:
[2-(Methylamino)-5-nitrophenyl]phenylmethanone, with the CAS number 4958-56-9, is an organic compound characterized by its complex structure, which includes a phenylmethanone moiety and a nitrophenyl group substituted with a methylamino group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the nitro group suggests that it may have electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. The methylamino group can impart basic properties, allowing for interactions with acids and other electrophiles. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic applications. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on purity and environmental conditions. Overall, [2-(Methylamino)-5-nitrophenyl]phenylmethanone represents a versatile structure with potential applications in organic synthesis and medicinal chemistry.
Formula:C14H12N2O3
InChI:InChI=1S/C14H12N2O3/c1-15-13-8-7-11(16(18)19)9-12(13)14(17)10-5-3-2-4-6-10/h2-9,15H,1H3
InChI key:InChIKey=KIWZKBUUWJTGPP-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(NC)C=CC(N(=O)=O)=C1)C2=CC=CC=C2
Synonyms:- Benzophenone, 2-(methylamino)-5-nitro-
- Methanone, [2-(methylamino)-5-nitrophenyl]phenyl-
- [2-(Methylamino)-5-Nitrophenyl](Phenyl)Methanone
- [2-(Methylamino)-5-nitrophenyl]phenylmethanone
- 2-(Methylamino)-5-nitrobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2-Methylamino-5-nitrophenyl)phenylmethanone
CAS:Controlled ProductApplications (2-METHYLAMINO-5-NITRO-PHENYL)-PHENYL-METHANONE (cas# 4958-56-9) is a useful research chemical.
Formula:C14H12N2O3Color and Shape:YellowMolecular weight:256.25
