CAS 49600-34-2
:1-(6-methylpyridin-2-yl)thiourea
Description:
1-(6-Methylpyridin-2-yl)thiourea is an organic compound characterized by the presence of a thiourea functional group and a pyridine ring substituted with a methyl group. Its molecular structure features a thiourea moiety, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to two amine groups. The pyridine ring contributes to the compound's aromatic properties and can influence its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the thiourea group. It is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity and ability to form coordination complexes with metals. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups in a given reaction context. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H9N3S
InChI:InChI=1/C7H9N3S/c1-5-3-2-4-6(9-5)10-7(8)11/h2-4H,1H3,(H3,8,9,10,11)
SMILES:Cc1cccc(n1)NC(=N)S
Synonyms:- Thiourea, N-(6-methyl-2-pyridinyl)-
- 1-(6-Methylpyridin-2-yl)thiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(6-Methyl-2-pyridyl)thiourea, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H9N3SPurity:97%Color and Shape:Pale cream, PowderMolecular weight:167.23

