CAS 49612-09-1

6-Fluoro-4-hydrazinoquinoline

Description:

6-Fluoro-4-hydrazinoquinoline is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. The presence of a fluorine atom at the 6-position and a hydrazino group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its hydrazino group can participate in various chemical reactions, making it a candidate for further derivatization in medicinal chemistry. The fluorine substituent can enhance the compound's lipophilicity and influence its pharmacokinetic properties. 6-Fluoro-4-hydrazinoquinoline has garnered interest in research for its potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-microbial agents. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₉H₈FN₃

InChI: InChI=1/C9H8FN3/c10-6-1-2-8-7(5-6)9(13-11)3-4-12-8/h1-5H,11H2,(H,12,13)

SMILES: c1cc2c(cc1F)c(=NN)cc[nH]2

Synonyms:

• 6-FLUORO-4-HYDRAZINOQUINOLINE
• Quinoline, 6-fluoro-4-hydrazinyl-
• (6-fluoro-4-quinolinyl)hydrazine

6-Fluoro-4-hydrazinoquinoline

CAS: 49612-09-1

6-Fluoro-4-hydrazinoquinoline

Purity: ≥95%

Molecular weight: 177.18g/mol

Ref: 54-PC7186