CymitQuimica logo

CAS 49619-58-1

:

3-formyl-6-isopropylchromone

Description:
3-Formyl-6-isopropylchromone is an organic compound belonging to the chromone family, characterized by a chromone backbone with specific substituents. The compound features a formyl group (-CHO) at the 3-position and an isopropyl group at the 6-position of the chromone ring. This structure contributes to its unique chemical properties, including potential reactivity due to the aldehyde functional group, which can participate in various chemical reactions such as condensation and oxidation. The presence of the isopropyl group may influence the compound's solubility and steric hindrance, affecting its interactions with other molecules. 3-Formyl-6-isopropylchromone may exhibit biological activity, making it of interest in medicinal chemistry and natural product synthesis. Its properties, such as melting point, boiling point, and spectral characteristics (NMR, IR, UV-Vis), would be essential for identifying and characterizing the compound in laboratory settings. Overall, this compound represents a fascinating area of study within organic chemistry and its applications in various fields.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-8(2)9-3-4-12-11(5-9)13(15)10(6-14)7-16-12/h3-8H,1-2H3
InChI key:FRRYMYQANNFABF-UHFFFAOYSA-N
SMILES:CC(C)c1ccc2c(c1)c(=O)c(C=O)co2
Synonyms:
  • 4H-1-Benzopyran-3-carboxaldehyde, 6-(1-methylethyl)-4-oxo-
  • 6-Isopropyl-4-oxo-4H-chromene-3-carbaldehyde
  • 4-oxo-6-(propan-2-yl)-4H-chromene-3-carbaldehyde
Found 7 products.