CAS 49619-82-1
:3-Bromochromone
Description:
3-Bromochromone is an organic compound belonging to the chromone family, characterized by a fused benzopyran structure. It features a bromine atom substituted at the 3-position of the chromone ring, which influences its chemical reactivity and properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic nature. 3-Bromochromone is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. Its structure allows for various chemical modifications, which can enhance its pharmacological profile. Additionally, it can participate in electrophilic aromatic substitution reactions due to the presence of the bromine atom, which can serve as a leaving group or a site for further functionalization. Overall, 3-Bromochromone is a versatile compound with applications in research and potential therapeutic uses.
Formula:C9H5BrO2
InChI:InChI=1/C9H5BrO2/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-5H
SMILES:c1ccc2c(c1)c(=O)c(co2)Br
Synonyms:- 4H-1-benzopyran-4-one, 3-bromo-
- 3-bromo-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Bromochromone, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H5BrO2Purity:97%Color and Shape:Crystals or powder or crystalline powder, Cream to pale yellow or pale brownMolecular weight:225.043-Bromo-4H-chromen-4-one
CAS:Formula:C9H5BrO2Purity:97%Color and Shape:SolidMolecular weight:225.03883-Bromochromone
CAS:Formula:C9H5BrO2Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:225.04





