CAS 49619-87-6

2-{4-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenoxy]phenyl}-5,7-dihydroxy-4H-chromen-4-one

Description:

The chemical substance known as "2-{4-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenoxy]phenyl}-5,7-dihydroxy-4H-chromen-4-one," with the CAS number 49619-87-6, is a flavonoid derivative characterized by its complex structure that includes multiple hydroxyl groups and chromenone moieties. This compound exhibits significant antioxidant properties due to the presence of hydroxyl groups, which can donate hydrogen atoms and neutralize free radicals. Its structural features suggest potential biological activities, including anti-inflammatory and anticancer effects, making it of interest in pharmacological research. The presence of methoxy and phenoxy groups may enhance its solubility and bioavailability. Additionally, the compound's stability and reactivity can be influenced by pH and environmental conditions, which are important considerations for its application in medicinal chemistry. Overall, this flavonoid derivative represents a class of compounds that are being explored for their therapeutic potential in various health-related applications.

Formula: C₃₁H₂₀O₁₀

InChI: InChI=1/C31H20O10/c1-38-24-7-4-16(26-14-23(37)31-21(35)10-18(33)12-29(31)41-26)8-27(24)39-19-5-2-15(3-6-19)25-13-22(36)30-20(34)9-17(32)11-28(30)40-25/h2-14,32-35H,1H3

SMILES: COc1ccc(cc1Oc1ccc(cc1)c1cc(=O)c2c(cc(cc2o1)O)O)c1cc(=O)c2c(cc(cc2o1)O)O

Synonyms:

• 4H-1-Benzopyran-4-one, 2-(4-(5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenoxy)phenyl)-5,7-dihydroxy-

4'-O-Methylochnaflavone

CAS: 49619-87-6

Formula: C₃₁H₂₀O₁₀

Purity: 98%

Molecular weight: 552.4845

Ref: IN-DA01UNO6

4'-O-Methylochnaflavone

CAS: 49619-87-6

4'-O-Methylochnaflavone

Purity: ≥98%

Molecular weight: 552.48g/mol

Ref: 54-BUP20131

Ochnaflavone 4''-methyl ether

CAS: 49619-87-6

Formula: C₃₁H₂₀O₁₀

Molecular weight: 552.49

Ref: 7W-GY7051

4'-O-Methylochnaflavone

CAS: 49619-87-6

4'-O-Methylochnaflavone is a biflavonoid compound extracted from the leaves of Ginkgo biloba L., which inhibits lymphocyte proliferation induced by Con A or LPS

Formula: C₃₁H₂₀O₁₀

Purity: 99.49%

Color and Shape: Solid

Molecular weight: 552.48

Ref: TM-TN1283

Ochnaflavone 4'-methyl ether

CAS: 49619-87-6

Formula: C₃₁H₂₀O₁₀

Purity: 95%~99%

Molecular weight: 552.491

Ref: BP-BP2020

4'-o-Methylochnaflavone

CAS: 49619-87-6

4'-o-Methylochnaflavone is a specialized flavonoid compound, which is a type of natural product often derived from plant sources. These compounds are typically found in various botanicals and have garnered attention due to their diverse biological activities. Flavonoids like 4'-o-Methylochnaflavone are known for their potential to interact with a variety of biological pathways through antioxidant, anti-inflammatory, and enzyme-modulating activities.

Formula: C₃₁H₂₀O₁₀

Purity: Min. 95%

Molecular weight: 552.5 g/mol

Ref: 3D-ZBA61987