CAS 49622-18-6
:3,3,4-trimethyldecane
Description:
3,3,4-Trimethyldecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C13H28, indicating it contains 13 carbon atoms and 28 hydrogen atoms. This compound features three methyl groups attached to a decane backbone, which contributes to its branched structure. As a result, 3,3,4-trimethyldecane exhibits lower boiling and melting points compared to its straight-chain counterparts, making it a liquid at room temperature. It is typically colorless and has a characteristic hydrocarbon odor. The compound is insoluble in water but soluble in organic solvents, reflecting its nonpolar nature. 3,3,4-Trimethyldecane is primarily used in research and industrial applications, including as a reference compound in studies of hydrocarbon behavior and properties. Its structural characteristics can influence its physical properties, such as viscosity and density, which are important in various chemical processes and applications. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H28
InChI:InChI=1/C13H28/c1-6-8-9-10-11-12(3)13(4,5)7-2/h12H,6-11H2,1-5H3
InChI key:InChIKey=AVICXEDVKYYQCS-UHFFFAOYSA-N
SMILES:C(C(CC)(C)C)(CCCCCC)C
Synonyms:- Decane, 3,3,4-trimethyl-
- 3,3,4-TRIMETHYLDECANE
- 3,3,4-Trimethyldecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-D-167006
Discontinued product
